C22H25F3N6O3 — CID 11155829
N-[6-[2-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-1H-benzimidazol-2-yl]acetamide (PubChem CID 11155829) has the molecular formula C22H25F3N6O3 and a molecular weight of 478.48 g/mol. Its IUPAC name is N-[6-[2-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-1H-benzimidazol-2-yl]acetamide.
| Compound Name | N-[6-[2-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-1H-benzimidazol-2-yl]acetamide |
|---|---|
| PubChem CID | 11155829 |
| Molecular Formula | C22H25F3N6O3 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | N-[6-[2-[[2-[2-(methylamino)ethoxy]-5-(trifluoromethyl)phenyl]carbamoylamino]ethyl]-1H-benzimidazol-2-yl]acetamide |
| SMILES | CNCCOc1ccc(C(F)(F)F)cc1NC(=O)NCCc1ccc2nc(NC(C)=O)[nH]c2c1 |
| InChI | InChI=1S/C22H25F3N6O3/c1-13(32)28-20-29-16-5-3-14(11-17(16)30-20)7-8-27-21(33)31-18-12-15(22(23,24)25)4-6-19(18)34-10-9-26-2/h3-6,11-12,26H,7-10H2,1-2H3,(H2,27,31,33)(H2,28,29,30,32) |
| InChIKey | WVNJAJZDJSJLER-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|