About tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate
tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate (PubChem CID 11155866) has the molecular formula C29H41NO3Si
and a molecular weight of 479.74 g/mol. Its IUPAC name is tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate |
| PubChem CID | 11155866 |
| Molecular Formula | C29H41NO3Si |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate |
| SMILES | C=CCCN(C(=O)OC(C)(C)C)[C@@H](C=C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H41NO3Si/c1-9-11-22-30(27(31)33-28(3,4)5)24(10-2)23-32-34(29(6,7)8,25-18-14-12-15-19-25)26-20-16-13-17-21-26/h9-10,12-21,24H,1-2,11,22-23H2,3-8H3/t24-/m0/s1 |
| InChIKey | GQTDPHFGPYQLDU-DEOSSOPVSA-N |
| XLogP | 5.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate?
The IUPAC name of tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate (CID 11155866) is tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate?
The canonical SMILES for tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate is C=CCCN(C(=O)OC(C)(C)C)[C@@H](C=C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate?
The InChIKey is GQTDPHFGPYQLDU-DEOSSOPVSA-N. The full InChI is InChI=1S/C29H41NO3Si/c1-9-11-22-30(27(31)33-28(3,4)5)24(10-2)23-32-34(29(6,7)8,25-18-14-12-15-19-25)26-20-16-13-17-21-26/h9-10,12-21,24H,1-2,11,22-23H2,3-8H3/t24-/m0/s1.
What are the key properties of tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate?
tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate has a molecular weight of 479.74 g/mol, XLogP of 5.93, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-but-3-enyl-N-[(2S)-1-[tert-butyl(diphenyl)silyl]oxybut-3-en-2-yl]carbamate is sourced from PubChem (CID 11155866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).