C21H25ClN4O — CID 111559108
1-[(4-chlorophenyl)methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methylguanidine (PubChem CID 111559108) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methylguanidine.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111559108 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCCC(=O)N1Cc2ccccc2C1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O/c1-23-21(25-13-16-8-10-19(22)11-9-16)24-12-4-7-20(27)26-14-17-5-2-3-6-18(17)15-26/h2-3,5-6,8-11H,4,7,12-15H2,1H3,(H2,23,24,25) |
| InChIKey | ZQMXUWJFSRKUNL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|