C17H32F3N5O3S — CID 111559228
2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111559228) has the molecular formula C17H32F3N5O3S and a molecular weight of 443.54 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111559228 |
| Molecular Formula | C17H32F3N5O3S |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-morpholin-4-ylpropyl)-3-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(/NCC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C17H32F3N5O3S/c1-16(2,24-8-10-28-11-9-24)13-23-15(21-3)22-12-14-4-6-25(7-5-14)29(26,27)17(18,19)20/h14H,4-13H2,1-3H3,(H2,21,22,23) |
| InChIKey | MCWRXORXBSWCFR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|