C23H20N2O6S2 — CID 11155958
(6R,8S)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide (PubChem CID 11155958) has the molecular formula C23H20N2O6S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is (6R,8S)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide.
| Compound Name | (6R,8S)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
|---|---|
| PubChem CID | 11155958 |
| Molecular Formula | C23H20N2O6S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | (6R,8S)-N-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenyl]-8-methyl-9-oxo-5,6-dihydrothiepino[4,5-f][1,3]benzodioxole-6-carboxamide |
| SMILES | C[C@@H]1S[C@@H](C(=O)Nc2ccc(CC3SC(=O)NC3=O)cc2)Cc2cc3c(cc2C1=O)OCO3 |
| InChI | InChI=1S/C23H20N2O6S2/c1-11-20(26)15-9-17-16(30-10-31-17)7-13(15)8-19(32-11)21(27)24-14-4-2-12(3-5-14)6-18-22(28)25-23(29)33-18/h2-5,7,9,11,18-19H,6,8,10H2,1H3,(H,24,27)(H,25,28,29)/t11-,18?,19+/m0/s1 |
| InChIKey | VXQUYIJOKZTPIY-XNCBRVNISA-N |
| XLogP | 3.18 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|