About 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid
3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid (PubChem CID 11156045) has the molecular formula C28H22Cl2N2O2
and a molecular weight of 489.40 g/mol. Its IUPAC name is 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid.
Molecular Properties
| Compound Name | 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid |
| PubChem CID | 11156045 |
| Molecular Formula | C28H22Cl2N2O2 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid |
| SMILES | O=C(O)C(c1ccccc1)C(c1ccccc1)N(/C=N/c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H22Cl2N2O2/c29-22-11-15-24(16-12-22)31-19-32(25-17-13-23(30)14-18-25)27(21-9-5-2-6-10-21)26(28(33)34)20-7-3-1-4-8-20/h1-19,26-27H,(H,33,34)/b31-19+ |
| InChIKey | AKSQPWWEAICCGP-ZCTHSVRISA-N |
| XLogP | 7.77 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid?
The IUPAC name of 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid (CID 11156045) is 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid.
What is the SMILES notation for 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid?
The canonical SMILES for 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid is O=C(O)C(c1ccccc1)C(c1ccccc1)N(/C=N/c1ccc(Cl)cc1)c1ccc(Cl)cc1.
What is the InChIKey of 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid?
The InChIKey is AKSQPWWEAICCGP-ZCTHSVRISA-N. The full InChI is InChI=1S/C28H22Cl2N2O2/c29-22-11-15-24(16-12-22)31-19-32(25-17-13-23(30)14-18-25)27(21-9-5-2-6-10-21)26(28(33)34)20-7-3-1-4-8-20/h1-19,26-27H,(H,33,34)/b31-19+.
What are the key properties of 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid?
3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid has a molecular weight of 489.40 g/mol, XLogP of 7.77, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-chloro-N-[(4-chlorophenyl)iminomethyl]anilino]-2,3-diphenylpropanoic acid is sourced from PubChem (CID 11156045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).