C24H31N3O — CID 11156095
7-heptan-4-yl-2-(2-methoxyphenyl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene (PubChem CID 11156095) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 7-heptan-4-yl-2-(2-methoxyphenyl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene.
| Compound Name | 7-heptan-4-yl-2-(2-methoxyphenyl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
|---|---|
| PubChem CID | 11156095 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 7-heptan-4-yl-2-(2-methoxyphenyl)-10-methyl-2,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene |
| SMILES | CCCC(CCC)N1CCc2cn(-c3ccccc3OC)c3nc(C)cc1c23 |
| InChI | InChI=1S/C24H31N3O/c1-5-9-19(10-6-2)26-14-13-18-16-27(20-11-7-8-12-22(20)28-4)24-23(18)21(26)15-17(3)25-24/h7-8,11-12,15-16,19H,5-6,9-10,13-14H2,1-4H3 |
| InChIKey | OVSLEUSXAAGOGG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |