C8H11Cl2NO2 — CID 111561130
(2,2-dichlorocyclopropyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 111561130) has the molecular formula C8H11Cl2NO2 and a molecular weight of 224.09 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (2,2-dichlorocyclopropyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 111561130 |
| Molecular Formula | C8H11Cl2NO2 |
| Molecular Weight | 224.09 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | (2,2-dichlorocyclopropyl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | O=C(C1CC1(Cl)Cl)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C8H11Cl2NO2/c9-8(10)3-6(8)7(13)11-2-1-5(12)4-11/h5-6,12H,1-4H2/t5-,6?/m1/s1 |
| InChIKey | QSVFJRAYSGZKSY-LWOQYNTDSA-N |
| XLogP | 0.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.09 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|