C16H18N2O2 — CID 111561139
(2,6-dimethylquinolin-3-yl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone (PubChem CID 111561139) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2,6-dimethylquinolin-3-yl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (2,6-dimethylquinolin-3-yl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 111561139 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (2,6-dimethylquinolin-3-yl)-[(3R)-3-hydroxypyrrolidin-1-yl]methanone |
| SMILES | Cc1ccc2nc(C)c(C(=O)N3CC[C@@H](O)C3)cc2c1 |
| InChI | InChI=1S/C16H18N2O2/c1-10-3-4-15-12(7-10)8-14(11(2)17-15)16(20)18-6-5-13(19)9-18/h3-4,7-8,13,19H,5-6,9H2,1-2H3/t13-/m1/s1 |
| InChIKey | YXWGRVVQDWSHCI-CYBMUJFWSA-N |
| XLogP | 2.06 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |