C26H52O5Si2 — CID 11156312
(4R,6R)-6-[(E,1R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-tri(propan-2-yl)silyloxybut-2-enyl]-4-methoxyoxan-2-one (PubChem CID 11156312) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (4R,6R)-6-[(E,1R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-tri(propan-2-yl)silyloxybut-2-enyl]-4-methoxyoxan-2-one.
| Compound Name | (4R,6R)-6-[(E,1R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-tri(propan-2-yl)silyloxybut-2-enyl]-4-methoxyoxan-2-one |
|---|---|
| PubChem CID | 11156312 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (4R,6R)-6-[(E,1R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-1-tri(propan-2-yl)silyloxybut-2-enyl]-4-methoxyoxan-2-one |
| SMILES | CO[C@H]1CC(=O)O[C@@H]([C@@H](/C=C(\C)CO[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C26H52O5Si2/c1-18(2)33(19(3)4,20(5)6)31-24(23-15-22(28-11)16-25(27)30-23)14-21(7)17-29-32(12,13)26(8,9)10/h14,18-20,22-24H,15-17H2,1-13H3/b21-14+/t22-,23-,24-/m1/s1 |
| InChIKey | PIYLPYMOQSJRGZ-GJEOPNOGSA-N |
| XLogP | 7.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|