C21H34N4O4S — CID 111564137
1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine (PubChem CID 111564137) has the molecular formula C21H34N4O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111564137 |
| Molecular Formula | C21H34N4O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1CCS(=O)(=O)CC1)NCc1cccc(OC)c1OC1CCCC1 |
| InChI | InChI=1S/C21H34N4O4S/c1-22-21(23-10-11-25-12-14-30(26,27)15-13-25)24-16-17-6-5-9-19(28-2)20(17)29-18-7-3-4-8-18/h5-6,9,18H,3-4,7-8,10-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | RKVPYLRCEMNYPS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|