C23H29FN4O3 — CID 111564175
2-[[N-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111564175) has the molecular formula C23H29FN4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-[[N-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[N-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111564175 |
| Molecular Formula | C23H29FN4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-[[N-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | C/N=C(\NCC(=O)Nc1ccc(F)cc1)NCc1cccc(OC)c1OC1CCCC1 |
| InChI | InChI=1S/C23H29FN4O3/c1-25-23(27-15-21(29)28-18-12-10-17(24)11-13-18)26-14-16-6-5-9-20(30-2)22(16)31-19-7-3-4-8-19/h5-6,9-13,19H,3-4,7-8,14-15H2,1-2H3,(H,28,29)(H2,25,26,27) |
| InChIKey | CRERSHHETGUZRA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|