C26H19F6NO3 — CID 11156434
6-[2-[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]cyclohexen-1-yl]pyridine-2-carboxylic acid (PubChem CID 11156434) has the molecular formula C26H19F6NO3 and a molecular weight of 507.43 g/mol. Its IUPAC name is 6-[2-[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]cyclohexen-1-yl]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]cyclohexen-1-yl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 11156434 |
| Molecular Formula | C26H19F6NO3 |
| Molecular Weight | 507.43 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 6-[2-[5-(trifluoromethyl)-2-[(2,4,5-trifluorophenyl)methoxy]phenyl]cyclohexen-1-yl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(C2=C(c3cc(C(F)(F)F)ccc3OCc3cc(F)c(F)cc3F)CCCC2)n1 |
| InChI | InChI=1S/C26H19F6NO3/c27-19-12-21(29)20(28)10-14(19)13-36-24-9-8-15(26(30,31)32)11-18(24)16-4-1-2-5-17(16)22-6-3-7-23(33-22)25(34)35/h3,6-12H,1-2,4-5,13H2,(H,34,35) |
| InChIKey | OZYZKFPNGIMLOM-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.43 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|