C23H32N4O3S — CID 111564588
2-[[N'-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111564588) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[[N'-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111564588 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 2-[[N'-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-N-(thiophen-2-ylmethyl)carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | COc1cccc(C/N=C(\NCC(=O)N(C)C)NCc2cccs2)c1OC1CCCC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-27(2)21(28)16-26-23(25-15-19-11-7-13-31-19)24-14-17-8-6-12-20(29-3)22(17)30-18-9-4-5-10-18/h6-8,11-13,18H,4-5,9-10,14-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | SSDQZAIBEKEFAB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|