C28H35NO8 — CID 11156538
[(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-3-(phenylmethoxycarbonylamino)-6-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 11156538) has the molecular formula C28H35NO8 and a molecular weight of 513.59 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-3-(phenylmethoxycarbonylamino)-6-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-3-(phenylmethoxycarbonylamino)-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 11156538 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-5-hydroxy-2-pent-4-enoxy-3-(phenylmethoxycarbonylamino)-6-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | C=CCCCO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](OC(C)=O)[C@H]1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H35NO8/c1-3-4-11-16-34-27-24(29-28(32)35-18-22-14-9-6-10-15-22)26(36-20(2)30)25(31)23(37-27)19-33-17-21-12-7-5-8-13-21/h3,5-10,12-15,23-27,31H,1,4,11,16-19H2,2H3,(H,29,32)/t23-,24-,25-,26-,27-/m1/s1 |
| InChIKey | JHEJDKXNCMODFO-RFNQJFSXSA-N |
| XLogP | 3.50 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|