C22H24ClF5N6O — CID 11156635
5-chloro-6-[2,6-difluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 11156635) has the molecular formula C22H24ClF5N6O and a molecular weight of 518.92 g/mol. Its IUPAC name is 5-chloro-6-[2,6-difluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-[2,6-difluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11156635 |
| Molecular Formula | C22H24ClF5N6O |
| Molecular Weight | 518.92 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 5-chloro-6-[2,6-difluoro-4-(3-piperidin-1-ylpropoxy)phenyl]-N-[(2S)-1,1,1-trifluoropropan-2-yl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(OCCCN3CCCCC3)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C22H24ClF5N6O/c1-13(22(26,27)28)31-20-18(19(23)32-21-29-12-30-34(20)21)17-15(24)10-14(11-16(17)25)35-9-5-8-33-6-3-2-4-7-33/h10-13,31H,2-9H2,1H3/t13-/m0/s1 |
| InChIKey | UWVYORNWUVNEHV-ZDUSSCGKSA-N |
| XLogP | 5.34 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.92 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|