C18H27F2N3O2 — CID 111566629
1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111566629) has the molecular formula C18H27F2N3O2 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111566629 |
| Molecular Formula | C18H27F2N3O2 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCCc1cccc(F)c1F |
| InChI | InChI=1S/C18H27F2N3O2/c1-21-18(22-9-4-11-24-13-15-6-3-12-25-15)23-10-8-14-5-2-7-16(19)17(14)20/h2,5,7,15H,3-4,6,8-13H2,1H3,(H2,21,22,23) |
| InChIKey | JZKYTJXYSHMQID-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|