C28H26FN5O5 — CID 11156841
8-amino-18-[4-(dimethylamino)butylamino]-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid (PubChem CID 11156841) has the molecular formula C28H26FN5O5 and a molecular weight of 531.54 g/mol. Its IUPAC name is 8-amino-18-[4-(dimethylamino)butylamino]-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid.
| Compound Name | 8-amino-18-[4-(dimethylamino)butylamino]-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid |
|---|---|
| PubChem CID | 11156841 |
| Molecular Formula | C28H26FN5O5 |
| Molecular Weight | 531.54 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | 8-amino-18-[4-(dimethylamino)butylamino]-19-fluoro-22-oxo-5,16-dioxa-1,12-diazahexacyclo[15.7.1.02,15.04,13.06,11.021,25]pentacosa-2(15),3,6(11),7,9,13,17(25),18,20,23-decaene-23-carboxylic acid |
| SMILES | CN(C)CCCCNc1c(F)cc2c(=O)c(C(=O)O)cn3c4cc5oc6cc(N)ccc6[nH]c5cc4oc1c23 |
| InChI | InChI=1S/C28H26FN5O5/c1-33(2)8-4-3-7-31-24-17(29)10-15-25-27(24)39-23-11-19-22(38-21-9-14(30)5-6-18(21)32-19)12-20(23)34(25)13-16(26(15)35)28(36)37/h5-6,9-13,31-32H,3-4,7-8,30H2,1-2H3,(H,36,37) |
| InChIKey | KYWBJCODGIFNKB-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|