C34H50O3Si — CID 11156894
(2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxane-2-carbaldehyde (PubChem CID 11156894) has the molecular formula C34H50O3Si and a molecular weight of 534.86 g/mol. Its IUPAC name is (2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxane-2-carbaldehyde.
| Compound Name | (2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11156894 |
| Molecular Formula | C34H50O3Si |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | (2R,5R,6R)-5-[tert-butyl(diphenyl)silyl]oxy-6-[(Z)-dodec-2-enyl]oxane-2-carbaldehyde |
| SMILES | CCCCCCCCC/C=C\C[C@H]1O[C@@H](C=O)CC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H50O3Si/c1-5-6-7-8-9-10-11-12-13-20-25-32-33(27-26-29(28-35)36-32)37-38(34(2,3)4,30-21-16-14-17-22-30)31-23-18-15-19-24-31/h13-24,28-29,32-33H,5-12,25-27H2,1-4H3/b20-13-/t29-,32-,33-/m1/s1 |
| InChIKey | SRYAXQDKGMZUEC-KPOQHPOPSA-N |
| XLogP | 7.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|