C22H28ClFN4O — CID 111568993
3-[[[[[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide (PubChem CID 111568993) has the molecular formula C22H28ClFN4O and a molecular weight of 418.94 g/mol. Its IUPAC name is 3-[[[[[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide.
| Compound Name | 3-[[[[[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 111568993 |
| Molecular Formula | C22H28ClFN4O |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 3-[[[[[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]amino]-(ethylamino)methylidene]amino]methyl]-N-methylbenzamide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NC)c1)NCC(C)(C)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C22H28ClFN4O/c1-5-26-21(27-13-15-7-6-8-16(11-15)20(29)25-4)28-14-22(2,3)18-10-9-17(24)12-19(18)23/h6-12H,5,13-14H2,1-4H3,(H,25,29)(H2,26,27,28) |
| InChIKey | OAXHQIFETPECIE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|