C19H36N4O3 — CID 111569491
methyl 7-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]heptanoate (PubChem CID 111569491) has the molecular formula C19H36N4O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is methyl 7-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]heptanoate.
| Compound Name | methyl 7-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111569491 |
| Molecular Formula | C19H36N4O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | methyl 7-[[N-[[1-(dimethylcarbamoyl)cyclopentyl]methyl]-N'-methylcarbamimidoyl]amino]heptanoate |
| SMILES | C/N=C(\NCCCCCCC(=O)OC)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C19H36N4O3/c1-20-18(21-14-10-6-5-7-11-16(24)26-4)22-15-19(12-8-9-13-19)17(25)23(2)3/h5-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | NOJTTZBIMNCLFE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|