C22H35IN4O — CID 111570792
N,N-dimethyl-1-[[[N'-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide (PubChem CID 111570792) has the molecular formula C22H35IN4O and a molecular weight of 498.45 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111570792 |
| Molecular Formula | C22H35IN4O |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCC1CCCc2ccccc21)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C22H34N4O.HI/c1-23-21(25-16-22(13-6-7-14-22)20(27)26(2)3)24-15-18-11-8-10-17-9-4-5-12-19(17)18;/h4-5,9,12,18H,6-8,10-11,13-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | MGXDECMGGPNFKN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|