C20H33N5O3S — CID 111570867
1-[[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide (PubChem CID 111570867) has the molecular formula C20H33N5O3S and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-[[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide.
| Compound Name | 1-[[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111570867 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1-[[[N-[[4-(dimethylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N(C)C)cc1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C20H33N5O3S/c1-21-19(23-15-20(12-6-7-13-20)18(26)24(2)3)22-14-16-8-10-17(11-9-16)29(27,28)25(4)5/h8-11H,6-7,12-15H2,1-5H3,(H2,21,22,23) |
| InChIKey | UOMNDCCTMMKQRI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|