C20H31F2IN4O3 — CID 111571572
1-[[[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide (PubChem CID 111571572) has the molecular formula C20H31F2IN4O3 and a molecular weight of 540.39 g/mol. Its IUPAC name is 1-[[[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide.
| Compound Name | 1-[[[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111571572 |
| Molecular Formula | C20H31F2IN4O3 |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 1-[[[N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-N'-methylcarbamimidoyl]amino]methyl]-N,N-dimethylcyclopentane-1-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC(F)F)c1)NCC1(C(=O)N(C)C)CCCC1.I |
| InChI | InChI=1S/C20H30F2N4O3.HI/c1-23-19(25-13-20(9-5-6-10-20)17(27)26(2)3)24-12-14-7-8-15(28-4)16(11-14)29-18(21)22;/h7-8,11,18H,5-6,9-10,12-13H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | DWRGLABPGPQYBY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|