C22H32N6O — CID 111572077
N,N-dimethyl-1-[[[N'-methyl-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide (PubChem CID 111572077) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is N,N-dimethyl-1-[[[N'-methyl-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide.
| Compound Name | N,N-dimethyl-1-[[[N'-methyl-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 111572077 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | N,N-dimethyl-1-[[[N'-methyl-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]carbamimidoyl]amino]methyl]cyclopentane-1-carboxamide |
| SMILES | C/N=C(/NCc1cccc(Cn2cccn2)c1)NCC1(C(=O)N(C)C)CCCC1 |
| InChI | InChI=1S/C22H32N6O/c1-23-21(25-17-22(10-4-5-11-22)20(29)27(2)3)24-15-18-8-6-9-19(14-18)16-28-13-7-12-26-28/h6-9,12-14H,4-5,10-11,15-17H2,1-3H3,(H2,23,24,25) |
| InChIKey | UVZQGMIZTJXULC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|