C18H20BrClN4 — CID 111572503
1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine (PubChem CID 111572503) has the molecular formula C18H20BrClN4 and a molecular weight of 407.74 g/mol. Its IUPAC name is 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111572503 |
| Molecular Formula | C18H20BrClN4 |
| Molecular Weight | 407.74 g/mol |
| Exact Mass | 406.06 |
| IUPAC Name | 1-[[1-(3-bromophenyl)cyclopropyl]methyl]-3-[(6-chloro-3-pyridinyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(Cl)nc1)NCC1(c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C18H20BrClN4/c1-21-17(23-11-13-5-6-16(20)22-10-13)24-12-18(7-8-18)14-3-2-4-15(19)9-14/h2-6,9-10H,7-8,11-12H2,1H3,(H2,21,23,24) |
| InChIKey | MYXDOIHWTXCKSJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|