C17H30IN3O4S — CID 111573500
1-(2-tert-butylsulfonylethyl)-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111573500) has the molecular formula C17H30IN3O4S and a molecular weight of 499.42 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111573500 |
| Molecular Formula | C17H30IN3O4S |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-[(2,4-dimethoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)C(C)(C)C)NCc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C17H29N3O4S.HI/c1-17(2,3)25(21,22)10-9-19-16(18-4)20-12-13-7-8-14(23-5)11-15(13)24-6;/h7-8,11H,9-10,12H2,1-6H3,(H2,18,19,20);1H |
| InChIKey | OWNBELSRYHVXQG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|