C29H34Cl2N4O4 — CID 11157411
2-[1-[2-(4-amino-3,5-dichlorophenyl)acetyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 11157411) has the molecular formula C29H34Cl2N4O4 and a molecular weight of 573.52 g/mol. Its IUPAC name is 2-[1-[2-(4-amino-3,5-dichlorophenyl)acetyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 2-[1-[2-(4-amino-3,5-dichlorophenyl)acetyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 11157411 |
| Molecular Formula | C29H34Cl2N4O4 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 2-[1-[2-(4-amino-3,5-dichlorophenyl)acetyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)Cc4cc(Cl)c(N)c(Cl)c4)CC3)C(=O)C3CCCCC23)cc1OC |
| InChI | InChI=1S/C29H34Cl2N4O4/c1-38-24-8-7-18(16-25(24)39-2)28-20-5-3-4-6-21(20)29(37)35(33-28)19-9-11-34(12-10-19)26(36)15-17-13-22(30)27(32)23(31)14-17/h7-8,13-14,16,19-21H,3-6,9-12,15,32H2,1-2H3 |
| InChIKey | IYFYVESFLTVJOM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|