C23H37N5O3 — CID 111574111
2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine (PubChem CID 111574111) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine.
| Compound Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111574111 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 2-[3-(3-ethoxy-4-methoxyphenyl)propyl]-1-ethyl-3-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCc1ccc(OC)c(OCC)c1)NCCCc1nc(C(C)C)no1 |
| InChI | InChI=1S/C23H37N5O3/c1-6-24-23(26-15-9-11-21-27-22(17(3)4)28-31-21)25-14-8-10-18-12-13-19(29-5)20(16-18)30-7-2/h12-13,16-17H,6-11,14-15H2,1-5H3,(H2,24,25,26) |
| InChIKey | FLIANNHLIGTLOS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|