C23H31N3O2 — CID 111574791
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[3-(3-ethoxy-4-methoxyphenyl)propyl]-2-methylguanidine (PubChem CID 111574791) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[3-(3-ethoxy-4-methoxyphenyl)propyl]-2-methylguanidine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[3-(3-ethoxy-4-methoxyphenyl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111574791 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[3-(3-ethoxy-4-methoxyphenyl)propyl]-2-methylguanidine |
| SMILES | CCOc1cc(CCCN/C(=N\C)NCC2Cc3ccccc32)ccc1OC |
| InChI | InChI=1S/C23H31N3O2/c1-4-28-22-14-17(11-12-21(22)27-3)8-7-13-25-23(24-2)26-16-19-15-18-9-5-6-10-20(18)19/h5-6,9-12,14,19H,4,7-8,13,15-16H2,1-3H3,(H2,24,25,26) |
| InChIKey | PHPVSTWSCDWTJU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|