C33H66O4Si2 — CID 11157520
tert-butyl-[(E,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-10-[(8S,9R)-8-methyl-6,10-dioxaspiro[4.5]decan-9-yl]dec-8-enoxy]-dimethylsilane (PubChem CID 11157520) has the molecular formula C33H66O4Si2 and a molecular weight of 583.06 g/mol. Its IUPAC name is tert-butyl-[(E,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-10-[(8S,9R)-8-methyl-6,10-dioxaspiro[4.5]decan-9-yl]dec-8-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-10-[(8S,9R)-8-methyl-6,10-dioxaspiro[4.5]decan-9-yl]dec-8-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11157520 |
| Molecular Formula | C33H66O4Si2 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | tert-butyl-[(E,5S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6,8-dimethyl-10-[(8S,9R)-8-methyl-6,10-dioxaspiro[4.5]decan-9-yl]dec-8-enoxy]-dimethylsilane |
| SMILES | C/C(=C\C[C@H]1OC2(CCCC2)OC[C@@H]1C)C[C@H](C)[C@H](CCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H66O4Si2/c1-26(19-20-29-28(3)25-34-33(36-29)21-15-16-22-33)24-27(2)30(37-39(12,13)32(7,8)9)18-14-17-23-35-38(10,11)31(4,5)6/h19,27-30H,14-18,20-25H2,1-13H3/b26-19+/t27-,28-,29+,30-/m0/s1 |
| InChIKey | RSUXPVRVYHSCTN-JNVAYOSOSA-N |
| XLogP | 10.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|