C16H28IN3OS — CID 111575224
1-(2-cycloheptyloxyethyl)-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111575224) has the molecular formula C16H28IN3OS and a molecular weight of 437.39 g/mol. Its IUPAC name is 1-(2-cycloheptyloxyethyl)-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-cycloheptyloxyethyl)-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111575224 |
| Molecular Formula | C16H28IN3OS |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1-(2-cycloheptyloxyethyl)-2-methyl-3-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOC1CCCCCC1)NCc1ccsc1.I |
| InChI | InChI=1S/C16H27N3OS.HI/c1-17-16(19-12-14-8-11-21-13-14)18-9-10-20-15-6-4-2-3-5-7-15;/h8,11,13,15H,2-7,9-10,12H2,1H3,(H2,17,18,19);1H |
| InChIKey | ZZXKDZIIQIEFAD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|