C34H26Cl2N4O2 — CID 11157644
2,5-dichloro-3-[(9-ethylcarbazol-2-yl)amino]-6-[(9-ethylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione (PubChem CID 11157644) has the molecular formula C34H26Cl2N4O2 and a molecular weight of 593.51 g/mol. Its IUPAC name is 2,5-dichloro-3-[(9-ethylcarbazol-2-yl)amino]-6-[(9-ethylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dichloro-3-[(9-ethylcarbazol-2-yl)amino]-6-[(9-ethylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11157644 |
| Molecular Formula | C34H26Cl2N4O2 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 2,5-dichloro-3-[(9-ethylcarbazol-2-yl)amino]-6-[(9-ethylcarbazol-3-yl)amino]cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCn1c2ccccc2c2cc(NC3=C(Cl)C(=O)C(Nc4ccc5c6ccccc6n(CC)c5c4)=C(Cl)C3=O)ccc21 |
| InChI | InChI=1S/C34H26Cl2N4O2/c1-3-39-26-12-8-6-10-22(26)24-17-19(14-16-27(24)39)37-31-29(35)34(42)32(30(36)33(31)41)38-20-13-15-23-21-9-5-7-11-25(21)40(4-2)28(23)18-20/h5-18,37-38H,3-4H2,1-2H3 |
| InChIKey | WCCLNRFPFWPAOM-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|