C34H30O8S — CID 11157679
[(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate (PubChem CID 11157679) has the molecular formula C34H30O8S and a molecular weight of 598.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11157679 |
| Molecular Formula | C34H30O8S |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-dibenzoyloxy-2-(hydroxymethyl)-6-(4-methylphenyl)sulfanyloxan-3-yl] benzoate |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H30O8S/c1-22-17-19-26(20-18-22)43-34-30(42-33(38)25-15-9-4-10-16-25)29(41-32(37)24-13-7-3-8-14-24)28(27(21-35)39-34)40-31(36)23-11-5-2-6-12-23/h2-20,27-30,34-35H,21H2,1H3/t27-,28-,29+,30-,34+/m1/s1 |
| InChIKey | VGOJOKPAEVYVKR-PXJJNHDGSA-N |
| XLogP | 5.48 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|