C23H30N4O2 — CID 111576909
N-benzyl-2-[[N'-[[2-(cyclopropylmethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide (PubChem CID 111576909) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-benzyl-2-[[N'-[[2-(cyclopropylmethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-2-[[N'-[[2-(cyclopropylmethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111576909 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-benzyl-2-[[N'-[[2-(cyclopropylmethoxy)phenyl]methyl]-N-ethylcarbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1ccccc1OCC1CC1)NCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H30N4O2/c1-2-24-23(27-16-22(28)25-14-18-8-4-3-5-9-18)26-15-20-10-6-7-11-21(20)29-17-19-12-13-19/h3-11,19H,2,12-17H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | VPQDKRUSOCQWLH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|