C32H31F5O4S — CID 11157748
6-(4-methoxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol (PubChem CID 11157748) has the molecular formula C32H31F5O4S and a molecular weight of 606.65 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol.
| Compound Name | 6-(4-methoxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 11157748 |
| Molecular Formula | C32H31F5O4S |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 6-(4-methoxyphenyl)-5-[4-[4-(4,4,5,5,5-pentafluoropentylsulfanyl)butoxy]phenoxy]naphthalen-2-ol |
| SMILES | COc1ccc(-c2ccc3cc(O)ccc3c2Oc2ccc(OCCCCSCCCC(F)(F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C32H31F5O4S/c1-39-25-9-5-22(6-10-25)28-15-7-23-21-24(38)8-16-29(23)30(28)41-27-13-11-26(12-14-27)40-18-2-3-19-42-20-4-17-31(33,34)32(35,36)37/h5-16,21,38H,2-4,17-20H2,1H3 |
| InChIKey | ASWWTGKAVCHYEQ-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|