C22H27N5O — CID 111577753
1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[[2-(cyclopropylmethoxy)phenyl]methyl]-2-methylguanidine (PubChem CID 111577753) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[[2-(cyclopropylmethoxy)phenyl]methyl]-2-methylguanidine.
| Compound Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[[2-(cyclopropylmethoxy)phenyl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111577753 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[2-(1H-benzimidazol-2-yl)ethyl]-3-[[2-(cyclopropylmethoxy)phenyl]methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1nc2ccccc2[nH]1)NCc1ccccc1OCC1CC1 |
| InChI | InChI=1S/C22H27N5O/c1-23-22(24-13-12-21-26-18-7-3-4-8-19(18)27-21)25-14-17-6-2-5-9-20(17)28-15-16-10-11-16/h2-9,16H,10-15H2,1H3,(H,26,27)(H2,23,24,25) |
| InChIKey | IJOINXPNMOXPFI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|