C16H16FNO3 — CID 111578636
N-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-5-methylbenzamide (PubChem CID 111578636) has the molecular formula C16H16FNO3 and a molecular weight of 289.31 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-5-methylbenzamide.
| Compound Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 111578636 |
| Molecular Formula | C16H16FNO3 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | N-[2-(2-fluorophenyl)-2-hydroxyethyl]-3-hydroxy-5-methylbenzamide |
| SMILES | Cc1cc(O)cc(C(=O)NCC(O)c2ccccc2F)c1 |
| InChI | InChI=1S/C16H16FNO3/c1-10-6-11(8-12(19)7-10)16(21)18-9-15(20)13-4-2-3-5-14(13)17/h2-8,15,19-20H,9H2,1H3,(H,18,21) |
| InChIKey | ISFHQGJTVWVUHI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |