C14H21NO2S — CID 111579392
[1-[[(4-methoxy-3-methylsulfanylphenyl)methylamino]methyl]cyclopropyl]methanol (PubChem CID 111579392) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is [1-[[(4-methoxy-3-methylsulfanylphenyl)methylamino]methyl]cyclopropyl]methanol.
| Compound Name | [1-[[(4-methoxy-3-methylsulfanylphenyl)methylamino]methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 111579392 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [1-[[(4-methoxy-3-methylsulfanylphenyl)methylamino]methyl]cyclopropyl]methanol |
| SMILES | COc1ccc(CNCC2(CO)CC2)cc1SC |
| InChI | InChI=1S/C14H21NO2S/c1-17-12-4-3-11(7-13(12)18-2)8-15-9-14(10-16)5-6-14/h3-4,7,15-16H,5-6,8-10H2,1-2H3 |
| InChIKey | DUPAIABOXOMLKC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |