C14H30N4O — CID 111579841
N-ethyl-2-[[ethylamino-(5-methylhexylamino)methylidene]amino]acetamide (PubChem CID 111579841) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is N-ethyl-2-[[ethylamino-(5-methylhexylamino)methylidene]amino]acetamide.
| Compound Name | N-ethyl-2-[[ethylamino-(5-methylhexylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111579841 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | N-ethyl-2-[[ethylamino-(5-methylhexylamino)methylidene]amino]acetamide |
| SMILES | CCNC(=O)C/N=C(\NCC)NCCCCC(C)C |
| InChI | InChI=1S/C14H30N4O/c1-5-15-13(19)11-18-14(16-6-2)17-10-8-7-9-12(3)4/h12H,5-11H2,1-4H3,(H,15,19)(H2,16,17,18) |
| InChIKey | ZZSREMUIBVWFCT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|