C17H23FIN3O — CID 111580780
1-[(2,5-dimethylfuran-3-yl)methyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111580780) has the molecular formula C17H23FIN3O and a molecular weight of 431.29 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-yl)methyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111580780 |
| Molecular Formula | C17H23FIN3O |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C)c(F)c1)NCc1cc(C)oc1C.I |
| InChI | InChI=1S/C17H22FN3O.HI/c1-11-5-6-14(8-16(11)18)9-20-17(19-4)21-10-15-7-12(2)22-13(15)3;/h5-8H,9-10H2,1-4H3,(H2,19,20,21);1H |
| InChIKey | OBCXOIZCDFXGJB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|