C20H29IN4OS — CID 111581310
1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111581310) has the molecular formula C20H29IN4OS and a molecular weight of 500.45 g/mol. Its IUPAC name is 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111581310 |
| Molecular Formula | C20H29IN4OS |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 1-[[6-(cyclopropylmethoxy)-3-pyridinyl]methyl]-2-methyl-3-(2-methyl-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OCC2CC2)nc1)NCC(C)(C)c1cccs1.I |
| InChI | InChI=1S/C20H28N4OS.HI/c1-20(2,17-5-4-10-26-17)14-24-19(21-3)23-12-16-8-9-18(22-11-16)25-13-15-6-7-15;/h4-5,8-11,15H,6-7,12-14H2,1-3H3,(H2,21,23,24);1H |
| InChIKey | RQKLHZFVWPXNJA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|