C21H30N4OS — CID 111581592
N-benzyl-N-ethyl-2-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]acetamide (PubChem CID 111581592) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111581592 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-benzyl-N-ethyl-2-[[N'-methyl-N-(2-methyl-2-thiophen-2-ylpropyl)carbamimidoyl]amino]acetamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CN/C(=N/C)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C21H30N4OS/c1-5-25(15-17-10-7-6-8-11-17)19(26)14-23-20(22-4)24-16-21(2,3)18-12-9-13-27-18/h6-13H,5,14-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | IBAMUZZKCWHJEN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|