C21H32N4O2S2 — CID 111581798
2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111581798) has the molecular formula C21H32N4O2S2 and a molecular weight of 436.65 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111581798 |
| Molecular Formula | C21H32N4O2S2 |
| Molecular Weight | 436.65 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-methyl-1-(2-methyl-2-thiophen-2-ylpropyl)-3-[[2-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccccc1CS(=O)(=O)NC(C)C)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C21H32N4O2S2/c1-16(2)25-29(26,27)14-18-10-7-6-9-17(18)13-23-20(22-5)24-15-21(3,4)19-11-8-12-28-19/h6-12,16,25H,13-15H2,1-5H3,(H2,22,23,24) |
| InChIKey | HCMCJDNRXGIHFM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.65 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|