C22H33IN6OS — CID 111583011
N-[2-[[N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111583011) has the molecular formula C22H33IN6OS and a molecular weight of 556.52 g/mol. Its IUPAC name is N-[2-[[N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111583011 |
| Molecular Formula | C22H33IN6OS |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[2-[[N'-[(1-benzylpyrrolidin-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCCN1Cc1ccccc1)NCCNC(=O)c1scnc1C.I |
| InChI | InChI=1S/C22H32N6OS.HI/c1-3-23-22(25-12-11-24-21(29)20-17(2)27-16-30-20)26-14-19-10-7-13-28(19)15-18-8-5-4-6-9-18;/h4-6,8-9,16,19H,3,7,10-15H2,1-2H3,(H,24,29)(H2,23,25,26);1H |
| InChIKey | YJHDDNKIOWQQDQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|