C21H35IN4O2 — CID 111589515
N-[2-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide (PubChem CID 111589515) has the molecular formula C21H35IN4O2 and a molecular weight of 502.44 g/mol. Its IUPAC name is N-[2-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111589515 |
| Molecular Formula | C21H35IN4O2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | N-[2-[[N-[2-(3-methoxy-4-methylphenyl)ethyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclohexanecarboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)C1CCCCC1)NCCc1ccc(C)c(OC)c1.I |
| InChI | InChI=1S/C21H34N4O2.HI/c1-16-9-10-17(15-19(16)27-3)11-12-24-21(22-2)25-14-13-23-20(26)18-7-5-4-6-8-18;/h9-10,15,18H,4-8,11-14H2,1-3H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | PIOYPNGDTWDGSV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|