C23H37IN6O — CID 111590282
1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111590282) has the molecular formula C23H37IN6O and a molecular weight of 540.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111590282 |
| Molecular Formula | C23H37IN6O |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1-ethyl-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCC(C)N1CCN(CC)CC1.I |
| InChI | InChI=1S/C23H36N6O.HI/c1-5-24-23(25-15-19(4)29-13-11-28(6-2)12-14-29)26-16-21-17-30-22(27-21)20-9-7-18(3)8-10-20;/h7-10,17,19H,5-6,11-16H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | MWHBCVSDSCWNIV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|