About (3S)-3-methylpent-1-yne
(3S)-3-methylpent-1-yne (PubChem CID 11159288) has the molecular formula C6H10
and a molecular weight of 82.15 g/mol. Its IUPAC name is (3S)-3-methylpent-1-yne.
Molecular Properties
| Compound Name | (3S)-3-methylpent-1-yne |
| PubChem CID | 11159288 |
| Molecular Formula | C6H10 |
| Molecular Weight | 82.15 g/mol |
| Exact Mass | 82.08 |
| IUPAC Name | (3S)-3-methylpent-1-yne |
| SMILES | C#C[C@@H](C)CC |
| InChI | InChI=1S/C6H10/c1-4-6(3)5-2/h1,6H,5H2,2-3H3/t6-/m1/s1 |
| InChIKey | PLHJCCHSCFNKCC-ZCFIWIBFSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-methylpent-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-methylpent-1-yne?
The IUPAC name of (3S)-3-methylpent-1-yne (CID 11159288) is (3S)-3-methylpent-1-yne.
What is the SMILES notation for (3S)-3-methylpent-1-yne?
The canonical SMILES for (3S)-3-methylpent-1-yne is C#C[C@@H](C)CC.
What is the InChIKey of (3S)-3-methylpent-1-yne?
The InChIKey is PLHJCCHSCFNKCC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C6H10/c1-4-6(3)5-2/h1,6H,5H2,2-3H3/t6-/m1/s1.
What are the key properties of (3S)-3-methylpent-1-yne?
(3S)-3-methylpent-1-yne has a molecular weight of 82.15 g/mol, XLogP of 1.67, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-methylpent-1-yne is sourced from PubChem (CID 11159288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).