C7H6O — CID 11159309
2,3,4,5,6-pentadeuteriobenzaldehyde (PubChem CID 11159309) has the molecular formula C7H6O and a molecular weight of 111.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentadeuteriobenzaldehyde.
| Compound Name | 2,3,4,5,6-pentadeuteriobenzaldehyde |
|---|---|
| PubChem CID | 11159309 |
| Molecular Formula | C7H6O |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 2,3,4,5,6-pentadeuteriobenzaldehyde |
| SMILES | [2H]c1c([2H])c([2H])c(C=O)c([2H])c1[2H] |
| InChI | InChI=1S/C7H6O/c8-6-7-4-2-1-3-5-7/h1-6H/i1D,2D,3D,4D,5D |
| InChIKey | HUMNYLRZRPPJDN-RALIUCGRSA-N |
| XLogP | 1.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|