C5H8O4 — CID 11159346
(3R,4S,5S)-3,4-dihydroxy-5-methyloxolan-2-one (PubChem CID 11159346) has the molecular formula C5H8O4 and a molecular weight of 132.11 g/mol. Its IUPAC name is (3R,4S,5S)-3,4-dihydroxy-5-methyloxolan-2-one.
| Compound Name | (3R,4S,5S)-3,4-dihydroxy-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 11159346 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.11 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (3R,4S,5S)-3,4-dihydroxy-5-methyloxolan-2-one |
| SMILES | C[C@@H]1OC(=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H8O4/c1-2-3(6)4(7)5(8)9-2/h2-4,6-7H,1H3/t2-,3+,4+/m0/s1 |
| InChIKey | JYHWQRJRDKSSIF-PZGQECOJSA-N |
| XLogP | -1.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.11 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |